C11H10Cl2N4 — CID 10588017
4-(2,4-dichlorophenyl)-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 10588017) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.14 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 10588017 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1ncnc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H10Cl2N4/c1-17(2)11-15-6-14-10(16-11)8-4-3-7(12)5-9(8)13/h3-6H,1-2H3 |
| InChIKey | MOXGRUYZFRRMBJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |