C13H20O6 — CID 10588228
ethyl (3aS,7S,7aS)-7-ethoxy-2,2-dimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate (PubChem CID 10588228) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl (3aS,7S,7aS)-7-ethoxy-2,2-dimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate.
| Compound Name | ethyl (3aS,7S,7aS)-7-ethoxy-2,2-dimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate |
|---|---|
| PubChem CID | 10588228 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | ethyl (3aS,7S,7aS)-7-ethoxy-2,2-dimethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](OCC)[C@@H]2OC(C)(C)O[C@@H]2O1 |
| InChI | InChI=1S/C13H20O6/c1-5-15-8-7-9(11(14)16-6-2)17-12-10(8)18-13(3,4)19-12/h7-8,10,12H,5-6H2,1-4H3/t8-,10-,12-/m0/s1 |
| InChIKey | VQIGGHMCWYJFSU-PEXQALLHSA-N |
| XLogP | 1.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |