C15H21N3O2 — CID 10588447
4,4-dibutyl-2,6-dioxopiperidine-3,5-dicarbonitrile (PubChem CID 10588447) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4,4-dibutyl-2,6-dioxopiperidine-3,5-dicarbonitrile.
| Compound Name | 4,4-dibutyl-2,6-dioxopiperidine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 10588447 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4,4-dibutyl-2,6-dioxopiperidine-3,5-dicarbonitrile |
| SMILES | CCCCC1(CCCC)C(C#N)C(=O)NC(=O)C1C#N |
| InChI | InChI=1S/C15H21N3O2/c1-3-5-7-15(8-6-4-2)11(9-16)13(19)18-14(20)12(15)10-17/h11-12H,3-8H2,1-2H3,(H,18,19,20) |
| InChIKey | COTOEBYSUXVRHR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|