C18H29BO — CID 10588623
(3aS,6R,8aS)-6-[(E)-pent-1-enyl]-1-propyl-3,3-bis(trideuteriomethyl)-6,8a-dihydro-3aH-cyclohepta[c]oxaborole (PubChem CID 10588623) has the molecular formula C18H29BO and a molecular weight of 278.28 g/mol. Its IUPAC name is (3aS,6R,8aS)-6-[(E)-pent-1-enyl]-1-propyl-3,3-bis(trideuteriomethyl)-6,8a-dihydro-3aH-cyclohepta[c]oxaborole.
| Compound Name | (3aS,6R,8aS)-6-[(E)-pent-1-enyl]-1-propyl-3,3-bis(trideuteriomethyl)-6,8a-dihydro-3aH-cyclohepta[c]oxaborole |
|---|---|
| PubChem CID | 10588623 |
| Molecular Formula | C18H29BO |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (3aS,6R,8aS)-6-[(E)-pent-1-enyl]-1-propyl-3,3-bis(trideuteriomethyl)-6,8a-dihydro-3aH-cyclohepta[c]oxaborole |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])OB(CCC)[C@H]2C=C[C@@H](/C=C/CCC)C=C[C@H]21 |
| InChI | InChI=1S/C18H29BO/c1-5-7-8-9-15-10-12-16-17(13-11-15)19(14-6-2)20-18(16,3)4/h8-13,15-17H,5-7,14H2,1-4H3/b9-8+/t15-,16+,17-/m0/s1/i3D3,4D3 |
| InChIKey | BPEZQQPCKLKTGE-WFRLVCDLSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|