C16H22O4 — CID 10588656
(1S,2R,3R,6S,7R,8R)-2,7-bis(methoxymethyl)-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene (PubChem CID 10588656) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1S,2R,3R,6S,7R,8R)-2,7-bis(methoxymethyl)-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene.
| Compound Name | (1S,2R,3R,6S,7R,8R)-2,7-bis(methoxymethyl)-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene |
|---|---|
| PubChem CID | 10588656 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,2R,3R,6S,7R,8R)-2,7-bis(methoxymethyl)-1,6-dimethyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene |
| SMILES | COC[C@@]12[C@H]3C=C[C@](C)(O3)[C@]1(COC)[C@H]1C=C[C@]2(C)O1 |
| InChI | InChI=1S/C16H22O4/c1-13-7-5-12(19-13)16(10-18-4)14(2)8-6-11(20-14)15(13,16)9-17-3/h5-8,11-12H,9-10H2,1-4H3/t11-,12-,13+,14+,15+,16+/m1/s1 |
| InChIKey | KAAAOXHGPDNAQG-LGFJLYTPSA-N |
| XLogP | 1.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|