About ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate
ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate (PubChem CID 10588685) has the molecular formula C13H24F2O2Si
and a molecular weight of 278.42 g/mol. Its IUPAC name is ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate |
| PubChem CID | 10588685 |
| Molecular Formula | C13H24F2O2Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate |
| SMILES | CCCC/C=C(\C(F)(F)C(=O)OCC)[Si](C)(C)C |
| InChI | InChI=1S/C13H24F2O2Si/c1-6-8-9-10-11(18(3,4)5)13(14,15)12(16)17-7-2/h10H,6-9H2,1-5H3/b11-10+ |
| InChIKey | UGTUPHOOHHPUQA-ZHACJKMWSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate?
The IUPAC name of ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate (CID 10588685) is ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate.
What is the SMILES notation for ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate?
The canonical SMILES for ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate is CCCC/C=C(\C(F)(F)C(=O)OCC)[Si](C)(C)C.
What is the InChIKey of ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate?
The InChIKey is UGTUPHOOHHPUQA-ZHACJKMWSA-N. The full InChI is InChI=1S/C13H24F2O2Si/c1-6-8-9-10-11(18(3,4)5)13(14,15)12(16)17-7-2/h10H,6-9H2,1-5H3/b11-10+.
What are the key properties of ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate?
ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate has a molecular weight of 278.42 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2,2-difluoro-3-trimethylsilyloct-3-enoate is sourced from PubChem (CID 10588685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).