C15H22O3Si — CID 10588689
(1'R,2'R,6'R,7'R)-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one (PubChem CID 10588689) has the molecular formula C15H22O3Si and a molecular weight of 278.42 g/mol. Its IUPAC name is (1'R,2'R,6'R,7'R)-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one.
| Compound Name | (1'R,2'R,6'R,7'R)-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
|---|---|
| PubChem CID | 10588689 |
| Molecular Formula | C15H22O3Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (1'R,2'R,6'R,7'R)-4'-trimethylsilylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.0.02,6]dec-4-ene]-3'-one |
| SMILES | C[Si](C)(C)C1=C[C@@H]2[C@H](C1=O)[C@H]1CCC3(OCCO3)[C@@H]21 |
| InChI | InChI=1S/C15H22O3Si/c1-19(2,3)11-8-10-12(14(11)16)9-4-5-15(13(9)10)17-6-7-18-15/h8-10,12-13H,4-7H2,1-3H3/t9-,10-,12-,13-/m1/s1 |
| InChIKey | FTMHTVZKIPSRPW-FPQZTECRSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|