C18H33NO — CID 10588775
(NE)-N-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]hydroxylamine (PubChem CID 10588775) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is (NE)-N-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 10588775 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | (NE)-N-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]hydroxylamine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2/C(=N/O)CCC[C@]12C |
| InChI | InChI=1S/C18H33NO/c1-13(2)7-5-8-14(3)15-10-11-16-17(19-20)9-6-12-18(15,16)4/h13-16,20H,5-12H2,1-4H3/b19-17+/t14-,15-,16+,18-/m1/s1 |
| InChIKey | BFETVKVBNALWBJ-TYVKKBOBSA-N |
| XLogP | 5.50 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|