C17H23NOSi — CID 10589234
(1S,5Z,10S)-11-[tert-butyl(dimethyl)silyl]-11-azabicyclo[8.2.0]dodec-5-en-3,7-diyn-12-one (PubChem CID 10589234) has the molecular formula C17H23NOSi and a molecular weight of 285.46 g/mol. Its IUPAC name is (1S,5Z,10S)-11-[tert-butyl(dimethyl)silyl]-11-azabicyclo[8.2.0]dodec-5-en-3,7-diyn-12-one.
| Compound Name | (1S,5Z,10S)-11-[tert-butyl(dimethyl)silyl]-11-azabicyclo[8.2.0]dodec-5-en-3,7-diyn-12-one |
|---|---|
| PubChem CID | 10589234 |
| Molecular Formula | C17H23NOSi |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (1S,5Z,10S)-11-[tert-butyl(dimethyl)silyl]-11-azabicyclo[8.2.0]dodec-5-en-3,7-diyn-12-one |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@H]2CC#C/C=C\C#CC[C@@H]21 |
| InChI | InChI=1S/C17H23NOSi/c1-17(2,3)20(4,5)18-15-13-11-9-7-6-8-10-12-14(15)16(18)19/h6-7,14-15H,12-13H2,1-5H3/b7-6-/t14-,15-/m0/s1 |
| InChIKey | FDDCSBUUKBXYLL-BEWKBBBFSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|