About 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine
4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine (PubChem CID 10589235) has the molecular formula C20H31N
and a molecular weight of 285.47 g/mol. Its IUPAC name is 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine |
| PubChem CID | 10589235 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine |
| SMILES | CCCN(CCC)CCCCC1=CCCc2ccccc21 |
| InChI | InChI=1S/C20H31N/c1-3-15-21(16-4-2)17-8-7-11-19-13-9-12-18-10-5-6-14-20(18)19/h5-6,10,13-14H,3-4,7-9,11-12,15-17H2,1-2H3 |
| InChIKey | CICRTVAOKJIVPR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine?
The IUPAC name of 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine (CID 10589235) is 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine.
What is the SMILES notation for 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine?
The canonical SMILES for 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine is CCCN(CCC)CCCCC1=CCCc2ccccc21.
What is the InChIKey of 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine?
The InChIKey is CICRTVAOKJIVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N/c1-3-15-21(16-4-2)17-8-7-11-19-13-9-12-18-10-5-6-14-20(18)19/h5-6,10,13-14H,3-4,7-9,11-12,15-17H2,1-2H3.
What are the key properties of 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine?
4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine has a molecular weight of 285.47 g/mol, XLogP of 5.31, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydronaphthalen-1-yl)-N,N-dipropylbutan-1-amine is sourced from PubChem (CID 10589235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).