About 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide
2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide (PubChem CID 10589291) has the molecular formula C9H10N4O3S2
and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide |
| PubChem CID | 10589291 |
| Molecular Formula | C9H10N4O3S2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide |
| SMILES | NCC(=O)Nc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C9H10N4O3S2/c10-4-8(14)12-5-1-2-6-7(3-5)17-9(13-6)18(11,15)16/h1-3H,4,10H2,(H,12,14)(H2,11,15,16) |
| InChIKey | XKTOGAYSSPHDPM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide?
The IUPAC name of 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide (CID 10589291) is 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide.
What is the SMILES notation for 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide?
The canonical SMILES for 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide is NCC(=O)Nc1ccc2nc(S(N)(=O)=O)sc2c1.
What is the InChIKey of 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide?
The InChIKey is XKTOGAYSSPHDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3S2/c10-4-8(14)12-5-1-2-6-7(3-5)17-9(13-6)18(11,15)16/h1-3H,4,10H2,(H,12,14)(H2,11,15,16).
What are the key properties of 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide?
2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide has a molecular weight of 286.34 g/mol, XLogP of -0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2-sulfamoyl-1,3-benzothiazol-6-yl)acetamide is sourced from PubChem (CID 10589291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).