About (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol
(2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 10589349) has the molecular formula C12H12F3N3O2
and a molecular weight of 287.24 g/mol. Its IUPAC name is (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol |
| PubChem CID | 10589349 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | N[C@@H](CO)c1nc(Cc2ccc(C(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C12H12F3N3O2/c13-12(14,15)8-3-1-7(2-4-8)5-10-17-11(20-18-10)9(16)6-19/h1-4,9,19H,5-6,16H2/t9-/m0/s1 |
| InChIKey | FCMQONUVPDNMHR-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol?
The IUPAC name of (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol (CID 10589349) is (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol.
What is the SMILES notation for (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol?
The canonical SMILES for (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol is N[C@@H](CO)c1nc(Cc2ccc(C(F)(F)F)cc2)no1.
What is the InChIKey of (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol?
The InChIKey is FCMQONUVPDNMHR-VIFPVBQESA-N. The full InChI is InChI=1S/C12H12F3N3O2/c13-12(14,15)8-3-1-7(2-4-8)5-10-17-11(20-18-10)9(16)6-19/h1-4,9,19H,5-6,16H2/t9-/m0/s1.
What are the key properties of (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol?
(2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol has a molecular weight of 287.24 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-[3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethanol is sourced from PubChem (CID 10589349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).