methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate

C17H13N3O2 — CID 10589647

IUPACmethyl 2,6-dipyridin-2-ylpyridine-4-carboxylate
SMILESCOC(=O)c1cc(-c2ccccn2)nc(-c2ccccn2)c1
InChIInChI=1S/C17H13N3O2/c1-22-17(21)12-10-15(13-6-2-4-8-18-13)20-16(11-12)14-7-3-5-9-19-14/h2-11H,1H3
InChIKeyGEXSUZVSFVGSMZ-UHFFFAOYSA-N
MW291.31 g/mol
LogP2.99
Rot. Bonds3

About methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate

methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate (PubChem CID 10589647) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate.

Molecular Properties

Compound Namemethyl 2,6-dipyridin-2-ylpyridine-4-carboxylate
PubChem CID10589647
Molecular FormulaC17H13N3O2
Molecular Weight291.31 g/mol
Exact Mass291.10
IUPAC Namemethyl 2,6-dipyridin-2-ylpyridine-4-carboxylate
SMILESCOC(=O)c1cc(-c2ccccn2)nc(-c2ccccn2)c1
InChIInChI=1S/C17H13N3O2/c1-22-17(21)12-10-15(13-6-2-4-8-18-13)20-16(11-12)14-7-3-5-9-19-14/h2-11H,1H3
InChIKeyGEXSUZVSFVGSMZ-UHFFFAOYSA-N
XLogP2.99
TPSA64.97 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.31
LogP ≤ 52.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate?
The IUPAC name of methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate (CID 10589647) is methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate.
What is the SMILES notation for methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate?
The canonical SMILES for methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate is COC(=O)c1cc(-c2ccccn2)nc(-c2ccccn2)c1.
What is the InChIKey of methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate?
The InChIKey is GEXSUZVSFVGSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O2/c1-22-17(21)12-10-15(13-6-2-4-8-18-13)20-16(11-12)14-7-3-5-9-19-14/h2-11H,1H3.
What are the key properties of methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate?
methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate has a molecular weight of 291.31 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dipyridin-2-ylpyridine-4-carboxylate is sourced from PubChem (CID 10589647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).