About [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol
[9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol (PubChem CID 10589714) has the molecular formula C14H12O5S
and a molecular weight of 292.31 g/mol. Its IUPAC name is [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol.
Molecular Properties
| Compound Name | [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol |
| PubChem CID | 10589714 |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol |
| SMILES | O=S1(=O)c2c(CO)cccc2Oc2cccc(CO)c21 |
| InChI | InChI=1S/C14H12O5S/c15-7-9-3-1-5-11-13(9)20(17,18)14-10(8-16)4-2-6-12(14)19-11/h1-6,15-16H,7-8H2 |
| InChIKey | VBWSPLXZFFBNKK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol?
The IUPAC name of [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol (CID 10589714) is [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol.
What is the SMILES notation for [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol?
The canonical SMILES for [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol is O=S1(=O)c2c(CO)cccc2Oc2cccc(CO)c21.
What is the InChIKey of [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol?
The InChIKey is VBWSPLXZFFBNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O5S/c15-7-9-3-1-5-11-13(9)20(17,18)14-10(8-16)4-2-6-12(14)19-11/h1-6,15-16H,7-8H2.
What are the key properties of [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol?
[9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol has a molecular weight of 292.31 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(hydroxymethyl)-10,10-dioxophenoxathiin-1-yl]methanol is sourced from PubChem (CID 10589714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).