C13H18N4O4 — CID 10589869
(7S,8R)-8,11,13-trimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one (PubChem CID 10589869) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is (7S,8R)-8,11,13-trimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one.
| Compound Name | (7S,8R)-8,11,13-trimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one |
|---|---|
| PubChem CID | 10589869 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (7S,8R)-8,11,13-trimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one |
| SMILES | COc1nc(OC)c2c(n1)C(=O)N1CCC[C@H]1[C@@H](OC)N2 |
| InChI | InChI=1S/C13H18N4O4/c1-19-10-7-5-4-6-17(7)12(18)9-8(14-10)11(20-2)16-13(15-9)21-3/h7,10,14H,4-6H2,1-3H3/t7-,10+/m0/s1 |
| InChIKey | COGVZWUVYGBKSD-OIBJUYFYSA-N |
| XLogP | 0.50 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |