C15H18O4S — CID 10589896
[(1R,2R,4S,5R)-5-[(S)-(4-methylphenyl)sulfinyl]-4-[(E)-prop-1-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 10589896) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is [(1R,2R,4S,5R)-5-[(S)-(4-methylphenyl)sulfinyl]-4-[(E)-prop-1-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(1R,2R,4S,5R)-5-[(S)-(4-methylphenyl)sulfinyl]-4-[(E)-prop-1-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 10589896 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [(1R,2R,4S,5R)-5-[(S)-(4-methylphenyl)sulfinyl]-4-[(E)-prop-1-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | C/C=C/[C@@H]1O[C@H](CO)[C@H]2O[C@@]12[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H18O4S/c1-3-4-13-15(14(19-15)12(9-16)18-13)20(17)11-7-5-10(2)6-8-11/h3-8,12-14,16H,9H2,1-2H3/b4-3+/t12-,13+,14-,15-,20+/m1/s1 |
| InChIKey | CRFXLUOLRYXSQM-NXAZNJMXSA-N |
| XLogP | 1.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|