About N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine
N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 10590134) has the molecular formula C17H19N3S
and a molecular weight of 297.43 g/mol. Its IUPAC name is N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine |
| PubChem CID | 10590134 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(NCc2ccccc2)c2sccc2n1 |
| InChI | InChI=1S/C17H19N3S/c1-2-3-9-15-19-14-10-11-21-16(14)17(20-15)18-12-13-7-5-4-6-8-13/h4-8,10-11H,2-3,9,12H2,1H3,(H,18,19,20) |
| InChIKey | DVDMKLDPYXVOQQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine?
The IUPAC name of N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine (CID 10590134) is N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine is CCCCc1nc(NCc2ccccc2)c2sccc2n1.
What is the InChIKey of N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine?
The InChIKey is DVDMKLDPYXVOQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3S/c1-2-3-9-15-19-14-10-11-21-16(14)17(20-15)18-12-13-7-5-4-6-8-13/h4-8,10-11H,2-3,9,12H2,1H3,(H,18,19,20).
What are the key properties of N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine?
N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine has a molecular weight of 297.43 g/mol, XLogP of 4.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-butylthieno[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 10590134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).