C16H30O3Si — CID 10590222
(1R,2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptane-2-carbaldehyde (PubChem CID 10590222) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (1R,2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptane-2-carbaldehyde.
| Compound Name | (1R,2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptane-2-carbaldehyde |
|---|---|
| PubChem CID | 10590222 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (1R,2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptane-2-carbaldehyde |
| SMILES | CC1(C)[C@@H](C=O)[C@@]2(C)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-14(2,3)20(7,8)19-12-9-13-16(6,18-13)11(10-17)15(12,4)5/h10-13H,9H2,1-8H3/t11-,12-,13+,16-/m1/s1 |
| InChIKey | BRWSKRSTJPURAP-NFFDBFGFSA-N |
| XLogP | 3.78 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|