C21H33N — CID 10590294
3,3-dimethyl-1-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)butyl]piperidine (PubChem CID 10590294) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)butyl]piperidine.
| Compound Name | 3,3-dimethyl-1-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)butyl]piperidine |
|---|---|
| PubChem CID | 10590294 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 3,3-dimethyl-1-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)butyl]piperidine |
| SMILES | CC1(C)CCCN(CCCCC2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C21H33N/c1-21(2)14-8-16-22(17-21)15-6-5-10-19-12-7-11-18-9-3-4-13-20(18)19/h3-4,9,13,19H,5-8,10-12,14-17H2,1-2H3 |
| InChIKey | JAJILYYYWBUWHZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|