About 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine
2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 10590336) has the molecular formula C19H16N4
and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 10590336 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccccc2)c2[nH]c(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C19H16N4/c1-13-20-17-12-16(14-8-4-2-5-9-14)23-18(17)19(21-13)22-15-10-6-3-7-11-15/h2-12,23H,1H3,(H,20,21,22) |
| InChIKey | HDLPVGHOVBWOPQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine (CID 10590336) is 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine is Cc1nc(Nc2ccccc2)c2[nH]c(-c3ccccc3)cc2n1.
What is the InChIKey of 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
The InChIKey is HDLPVGHOVBWOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4/c1-13-20-17-12-16(14-8-4-2-5-9-14)23-18(17)19(21-13)22-15-10-6-3-7-11-15/h2-12,23H,1H3,(H,20,21,22).
What are the key properties of 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine has a molecular weight of 300.37 g/mol, XLogP of 4.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,6-diphenyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 10590336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).