C13H19NO7 — CID 10590396
dimethyl (1R,2R,10R,11S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecane-10,11-dicarboxylate (PubChem CID 10590396) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is dimethyl (1R,2R,10R,11S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecane-10,11-dicarboxylate.
| Compound Name | dimethyl (1R,2R,10R,11S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecane-10,11-dicarboxylate |
|---|---|
| PubChem CID | 10590396 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | dimethyl (1R,2R,10R,11S)-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecane-10,11-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2[C@H]3OC(C)(C)OC3CN2O[C@H]1C(=O)OC |
| InChI | InChI=1S/C13H19NO7/c1-13(2)19-6-5-14-8(9(6)20-13)7(11(15)17-3)10(21-14)12(16)18-4/h6-10H,5H2,1-4H3/t6?,7-,8+,9-,10+/m0/s1 |
| InChIKey | KEJYWSKONISJST-QCHRWEISSA-N |
| XLogP | -0.53 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |