About 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane]
5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] (PubChem CID 10590968) has the molecular formula C16H21BrO
and a molecular weight of 309.25 g/mol. Its IUPAC name is 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane].
Molecular Properties
| Compound Name | 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] |
| PubChem CID | 10590968 |
| Molecular Formula | C16H21BrO |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] |
| SMILES | CC(C)(C)c1cc(Br)cc2c1OCC21CCCC1 |
| InChI | InChI=1S/C16H21BrO/c1-15(2,3)12-8-11(17)9-13-14(12)18-10-16(13)6-4-5-7-16/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | LQYJUNZCBBLTNF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane]?
The IUPAC name of 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] (CID 10590968) is 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane].
What is the SMILES notation for 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane]?
The canonical SMILES for 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] is CC(C)(C)c1cc(Br)cc2c1OCC21CCCC1.
What is the InChIKey of 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane]?
The InChIKey is LQYJUNZCBBLTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrO/c1-15(2,3)12-8-11(17)9-13-14(12)18-10-16(13)6-4-5-7-16/h8-9H,4-7,10H2,1-3H3.
What are the key properties of 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane]?
5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] has a molecular weight of 309.25 g/mol, XLogP of 4.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-tert-butylspiro[2H-1-benzofuran-3,1'-cyclopentane] is sourced from PubChem (CID 10590968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).