C19H20O2S — CID 10591229
(4R,5R)-2-ethyl-2-methyl-5-phenyl-4-phenylsulfanyloxolan-3-one (PubChem CID 10591229) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is (4R,5R)-2-ethyl-2-methyl-5-phenyl-4-phenylsulfanyloxolan-3-one.
| Compound Name | (4R,5R)-2-ethyl-2-methyl-5-phenyl-4-phenylsulfanyloxolan-3-one |
|---|---|
| PubChem CID | 10591229 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (4R,5R)-2-ethyl-2-methyl-5-phenyl-4-phenylsulfanyloxolan-3-one |
| SMILES | CCC1(C)O[C@H](c2ccccc2)[C@@H](Sc2ccccc2)C1=O |
| InChI | InChI=1S/C19H20O2S/c1-3-19(2)18(20)17(22-15-12-8-5-9-13-15)16(21-19)14-10-6-4-7-11-14/h4-13,16-17H,3H2,1-2H3/t16-,17-,19?/m1/s1 |
| InChIKey | HWIZXJDPFMQHLP-QNZPCDNOSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |