C21H31NO — CID 10591308
(1R,3S,5R,9S,12R)-5-benzyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane (PubChem CID 10591308) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is (1R,3S,5R,9S,12R)-5-benzyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane.
| Compound Name | (1R,3S,5R,9S,12R)-5-benzyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane |
|---|---|
| PubChem CID | 10591308 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (1R,3S,5R,9S,12R)-5-benzyl-8,8,12-trimethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1C[C@@H](Cc3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C21H31NO/c1-15-9-10-18-19(11-15)23-20-13-17(14-22(20)21(18,2)3)12-16-7-5-4-6-8-16/h4-8,15,17-20H,9-14H2,1-3H3/t15-,17-,18-,19-,20+/m1/s1 |
| InChIKey | QRGFKNOFCUZIJJ-RUGGUXRKSA-N |
| XLogP | 4.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |