About 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium
5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium (PubChem CID 10591401) has the molecular formula C17H15N2S+
and a molecular weight of 279.39 g/mol. Its IUPAC name is 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium.
Molecular Properties
| Compound Name | 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium |
| PubChem CID | 10591401 |
| Molecular Formula | C17H15N2S+ |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium |
| SMILES | Cc1ccc2c(c1)Nc1c(c[n+](C)c3ccccc13)S2 |
| InChI | InChI=1S/C17H14N2S/c1-11-7-8-15-13(9-11)18-17-12-5-3-4-6-14(12)19(2)10-16(17)20-15/h3-10H,1-2H3/p+1 |
| InChIKey | YJQZTEHRPDECKB-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium?
The IUPAC name of 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium (CID 10591401) is 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium.
What is the SMILES notation for 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium?
The canonical SMILES for 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium is Cc1ccc2c(c1)Nc1c(c[n+](C)c3ccccc13)S2.
What is the InChIKey of 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium?
The InChIKey is YJQZTEHRPDECKB-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H14N2S/c1-11-7-8-15-13(9-11)18-17-12-5-3-4-6-14(12)19(2)10-16(17)20-15/h3-10H,1-2H3/p+1.
What are the key properties of 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium?
5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium has a molecular weight of 279.39 g/mol, XLogP of 4.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dimethyl-12H-quinolino[3,4-b][1,4]benzothiazin-5-ium is sourced from PubChem (CID 10591401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).