C16H10Cl2N2O — CID 10591544
(E)-1-(1H-benzimidazol-2-yl)-3-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 10591544) has the molecular formula C16H10Cl2N2O and a molecular weight of 317.18 g/mol. Its IUPAC name is (E)-1-(1H-benzimidazol-2-yl)-3-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(1H-benzimidazol-2-yl)-3-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10591544 |
| Molecular Formula | C16H10Cl2N2O |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (E)-1-(1H-benzimidazol-2-yl)-3-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H10Cl2N2O/c17-11-7-5-10(9-12(11)18)6-8-15(21)16-19-13-3-1-2-4-14(13)20-16/h1-9H,(H,19,20)/b8-6+ |
| InChIKey | NREROJRPSLDHEE-SOFGYWHQSA-N |
| XLogP | 4.77 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|