C26H29N3O2 — CID 1059167
N-[3-[[(2R)-butan-2-yl]carbamoyl]-4-pyrrolidin-1-ylphenyl]naphthalene-2-carboxamide (PubChem CID 1059167) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[3-[[(2R)-butan-2-yl]carbamoyl]-4-pyrrolidin-1-ylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[[(2R)-butan-2-yl]carbamoyl]-4-pyrrolidin-1-ylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 1059167 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[3-[[(2R)-butan-2-yl]carbamoyl]-4-pyrrolidin-1-ylphenyl]naphthalene-2-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NC(=O)c2ccc3ccccc3c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C26H29N3O2/c1-3-18(2)27-26(31)23-17-22(12-13-24(23)29-14-6-7-15-29)28-25(30)21-11-10-19-8-4-5-9-20(19)16-21/h4-5,8-13,16-18H,3,6-7,14-15H2,1-2H3,(H,27,31)(H,28,30)/t18-/m1/s1 |
| InChIKey | HNUXHLJDRUCNGP-GOSISDBHSA-N |
| XLogP | 5.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|