C18H25NO4 — CID 10591718
butyl (3R,3aS,7aR)-2-benzyl-3,3a,4,5,6,7a-hexahydropyrano[3,2-d][1,2]oxazole-3-carboxylate (PubChem CID 10591718) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is butyl (3R,3aS,7aR)-2-benzyl-3,3a,4,5,6,7a-hexahydropyrano[3,2-d][1,2]oxazole-3-carboxylate.
| Compound Name | butyl (3R,3aS,7aR)-2-benzyl-3,3a,4,5,6,7a-hexahydropyrano[3,2-d][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 10591718 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | butyl (3R,3aS,7aR)-2-benzyl-3,3a,4,5,6,7a-hexahydropyrano[3,2-d][1,2]oxazole-3-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1[C@@H]2CCCO[C@@H]2ON1Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-2-3-11-21-17(20)16-15-10-7-12-22-18(15)23-19(16)13-14-8-5-4-6-9-14/h4-6,8-9,15-16,18H,2-3,7,10-13H2,1H3/t15-,16+,18+/m0/s1 |
| InChIKey | FDKLEFCDNNHWNB-LZLYRXPVSA-N |
| XLogP | 2.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|