C20H32O3 — CID 10591815
ethyl (2R)-2-[(1S,3aS,7aR)-3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-6-methylhept-5-enoate (PubChem CID 10591815) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is ethyl (2R)-2-[(1S,3aS,7aR)-3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-6-methylhept-5-enoate.
| Compound Name | ethyl (2R)-2-[(1S,3aS,7aR)-3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-6-methylhept-5-enoate |
|---|---|
| PubChem CID | 10591815 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | ethyl (2R)-2-[(1S,3aS,7aR)-3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl]-6-methylhept-5-enoate |
| SMILES | CCOC(=O)[C@H](CCC=C(C)C)[C@H]1CC[C@]2(C)CCCC(=O)[C@H]12 |
| InChI | InChI=1S/C20H32O3/c1-5-23-19(22)16(9-6-8-14(2)3)15-11-13-20(4)12-7-10-17(21)18(15)20/h8,15-16,18H,5-7,9-13H2,1-4H3/t15-,16-,18+,20+/m1/s1 |
| InChIKey | PFXOUTQZMRZMBL-HBXLWWENSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|