C17H32O2Si2 — CID 10592101
[(3E,5E)-7,7-diethoxy-1-trimethylsilylhepta-3,5-dien-1-yn-3-yl]-trimethylsilane (PubChem CID 10592101) has the molecular formula C17H32O2Si2 and a molecular weight of 324.61 g/mol. Its IUPAC name is [(3E,5E)-7,7-diethoxy-1-trimethylsilylhepta-3,5-dien-1-yn-3-yl]-trimethylsilane.
| Compound Name | [(3E,5E)-7,7-diethoxy-1-trimethylsilylhepta-3,5-dien-1-yn-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10592101 |
| Molecular Formula | C17H32O2Si2 |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(3E,5E)-7,7-diethoxy-1-trimethylsilylhepta-3,5-dien-1-yn-3-yl]-trimethylsilane |
| SMILES | CCOC(/C=C/C=C(\C#C[Si](C)(C)C)[Si](C)(C)C)OCC |
| InChI | InChI=1S/C17H32O2Si2/c1-9-18-17(19-10-2)13-11-12-16(21(6,7)8)14-15-20(3,4)5/h11-13,17H,9-10H2,1-8H3/b13-11+,16-12+ |
| InChIKey | IRLWHIMMHQNNPY-PKRRCJCNSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|