C11H11F8NO — CID 10592114
(Z)-4,4,5,5,5-pentafluoro-1-piperidin-1-yl-3-(trifluoromethyl)pent-2-en-1-one (PubChem CID 10592114) has the molecular formula C11H11F8NO and a molecular weight of 325.20 g/mol. Its IUPAC name is (Z)-4,4,5,5,5-pentafluoro-1-piperidin-1-yl-3-(trifluoromethyl)pent-2-en-1-one.
| Compound Name | (Z)-4,4,5,5,5-pentafluoro-1-piperidin-1-yl-3-(trifluoromethyl)pent-2-en-1-one |
|---|---|
| PubChem CID | 10592114 |
| Molecular Formula | C11H11F8NO |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (Z)-4,4,5,5,5-pentafluoro-1-piperidin-1-yl-3-(trifluoromethyl)pent-2-en-1-one |
| SMILES | O=C(/C=C(\C(F)(F)F)C(F)(F)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C11H11F8NO/c12-9(13,11(17,18)19)7(10(14,15)16)6-8(21)20-4-2-1-3-5-20/h6H,1-5H2/b7-6- |
| InChIKey | HUYWNIZJXKGOPO-SREVYHEPSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|