C11H17F6NO3 — CID 10592116
N-methyl-2-(2,2,2-trifluoroethoxy)-N-[1-(2,2,2-trifluoroethoxy)propyl]propanamide (PubChem CID 10592116) has the molecular formula C11H17F6NO3 and a molecular weight of 325.25 g/mol. Its IUPAC name is N-methyl-2-(2,2,2-trifluoroethoxy)-N-[1-(2,2,2-trifluoroethoxy)propyl]propanamide.
| Compound Name | N-methyl-2-(2,2,2-trifluoroethoxy)-N-[1-(2,2,2-trifluoroethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 10592116 |
| Molecular Formula | C11H17F6NO3 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-methyl-2-(2,2,2-trifluoroethoxy)-N-[1-(2,2,2-trifluoroethoxy)propyl]propanamide |
| SMILES | CCC(OCC(F)(F)F)N(C)C(=O)C(C)OCC(F)(F)F |
| InChI | InChI=1S/C11H17F6NO3/c1-4-8(21-6-11(15,16)17)18(3)9(19)7(2)20-5-10(12,13)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | SXKFZLWHIHMHLS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|