C20H23NO3 — CID 10592149
(2S,3S,4S)-2-ethenyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine (PubChem CID 10592149) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S,3S,4S)-2-ethenyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine.
| Compound Name | (2S,3S,4S)-2-ethenyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine |
|---|---|
| PubChem CID | 10592149 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (2S,3S,4S)-2-ethenyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidine |
| SMILES | C=C[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1O |
| InChI | InChI=1S/C20H23NO3/c1-2-18-20(24-15-17-11-7-4-8-12-17)19(13-21(18)22)23-14-16-9-5-3-6-10-16/h2-12,18-20,22H,1,13-15H2/t18-,19-,20-/m0/s1 |
| InChIKey | KXQVTQNQFSEGIX-UFYCRDLUSA-N |
| XLogP | 3.42 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|