C20H23NO3 — CID 10592154
(3R,4S)-3-(4-phenylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol (PubChem CID 10592154) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (3R,4S)-3-(4-phenylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol.
| Compound Name | (3R,4S)-3-(4-phenylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol |
|---|---|
| PubChem CID | 10592154 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (3R,4S)-3-(4-phenylpiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol |
| SMILES | Oc1ccc2c(c1)OC[C@@H](N1CCC(c3ccccc3)CC1)[C@H]2O |
| InChI | InChI=1S/C20H23NO3/c22-16-6-7-17-19(12-16)24-13-18(20(17)23)21-10-8-15(9-11-21)14-4-2-1-3-5-14/h1-7,12,15,18,20,22-23H,8-11,13H2/t18-,20+/m1/s1 |
| InChIKey | INZMNXOELSZFKY-QUCCMNQESA-N |
| XLogP | 3.07 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |