About 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one
4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one (PubChem CID 10592220) has the molecular formula C19H19FN2O2
and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one |
| PubChem CID | 10592220 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2c(OCCN3CCc4ccccc4C3)ccc(F)c2N1 |
| InChI | InChI=1S/C19H19FN2O2/c20-16-5-6-17(15-11-18(23)21-19(15)16)24-10-9-22-8-7-13-3-1-2-4-14(13)12-22/h1-6H,7-12H2,(H,21,23) |
| InChIKey | UFPMVMHWBPUCTK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one?
The IUPAC name of 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one (CID 10592220) is 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one.
What is the SMILES notation for 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one?
The canonical SMILES for 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one is O=C1Cc2c(OCCN3CCc4ccccc4C3)ccc(F)c2N1.
What is the InChIKey of 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one?
The InChIKey is UFPMVMHWBPUCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O2/c20-16-5-6-17(15-11-18(23)21-19(15)16)24-10-9-22-8-7-13-3-1-2-4-14(13)12-22/h1-6H,7-12H2,(H,21,23).
What are the key properties of 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one?
4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one has a molecular weight of 326.37 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-7-fluoro-1,3-dihydroindol-2-one is sourced from PubChem (CID 10592220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).