About (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine
(2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine (PubChem CID 10592239) has the molecular formula C22H28N2
and a molecular weight of 320.48 g/mol. Its IUPAC name is (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine.
Molecular Properties
| Compound Name | (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine |
| PubChem CID | 10592239 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine |
| SMILES | C=CCN1C[C@H](C)N(C(c2ccccc2)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C22H28N2/c1-4-15-23-16-19(3)24(17-18(23)2)22(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h4-14,18-19,22H,1,15-17H2,2-3H3/t18-,19+/m1/s1 |
| InChIKey | VODDPJUIQWNVTH-MOPGFXCFSA-N |
| XLogP | 4.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine?
The IUPAC name of (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine (CID 10592239) is (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine.
What is the SMILES notation for (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine?
The canonical SMILES for (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine is C=CCN1C[C@H](C)N(C(c2ccccc2)c2ccccc2)C[C@H]1C.
What is the InChIKey of (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine?
The InChIKey is VODDPJUIQWNVTH-MOPGFXCFSA-N. The full InChI is InChI=1S/C22H28N2/c1-4-15-23-16-19(3)24(17-18(23)2)22(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h4-14,18-19,22H,1,15-17H2,2-3H3/t18-,19+/m1/s1.
What are the key properties of (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine?
(2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine has a molecular weight of 320.48 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-1-benzhydryl-2,5-dimethyl-4-prop-2-enylpiperazine is sourced from PubChem (CID 10592239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).