About methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate
methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate (PubChem CID 10592257) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate.
Molecular Properties
| Compound Name | methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate |
| PubChem CID | 10592257 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate |
| SMILES | CCCCCC(O)/C=C/[C@H]1CCC[C@@](O)(CCCC(=O)OC)C1 |
| InChI | InChI=1S/C19H34O4/c1-3-4-5-9-17(20)12-11-16-8-6-13-19(22,15-16)14-7-10-18(21)23-2/h11-12,16-17,20,22H,3-10,13-15H2,1-2H3/b12-11+/t16-,17?,19-/m1/s1 |
| InChIKey | QWJULMZQLQUNFL-IIIRJUFPSA-N |
| XLogP | 3.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate?
The IUPAC name of methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate (CID 10592257) is methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate.
What is the SMILES notation for methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate?
The canonical SMILES for methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate is CCCCCC(O)/C=C/[C@H]1CCC[C@@](O)(CCCC(=O)OC)C1.
What is the InChIKey of methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate?
The InChIKey is QWJULMZQLQUNFL-IIIRJUFPSA-N. The full InChI is InChI=1S/C19H34O4/c1-3-4-5-9-17(20)12-11-16-8-6-13-19(22,15-16)14-7-10-18(21)23-2/h11-12,16-17,20,22H,3-10,13-15H2,1-2H3/b12-11+/t16-,17?,19-/m1/s1.
What are the key properties of methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate?
methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate has a molecular weight of 326.48 g/mol, XLogP of 3.75, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]butanoate is sourced from PubChem (CID 10592257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).