C22H30O2 — CID 10592261
(12,12-dimethyl-6-propan-2-yl-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraenyl) acetate (PubChem CID 10592261) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (12,12-dimethyl-6-propan-2-yl-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraenyl) acetate.
| Compound Name | (12,12-dimethyl-6-propan-2-yl-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraenyl) acetate |
|---|---|
| PubChem CID | 10592261 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (12,12-dimethyl-6-propan-2-yl-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7-tetraenyl) acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C(C)C)CCC1C(=CCCC1(C)C)C2 |
| InChI | InChI=1S/C22H30O2/c1-14(2)19-12-16-8-9-20-17(7-6-10-22(20,4)5)11-18(16)13-21(19)24-15(3)23/h7,12-14,20H,6,8-11H2,1-5H3 |
| InChIKey | KLJIORPJAICLQA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|