About 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane
2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane (PubChem CID 10592414) has the molecular formula C15H20S4
and a molecular weight of 328.59 g/mol. Its IUPAC name is 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane |
| PubChem CID | 10592414 |
| Molecular Formula | C15H20S4 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane |
| SMILES | Cc1cc(C2SCCCS2)cc(C2SCCCS2)c1 |
| InChI | InChI=1S/C15H20S4/c1-11-8-12(14-16-4-2-5-17-14)10-13(9-11)15-18-6-3-7-19-15/h8-10,14-15H,2-7H2,1H3 |
| InChIKey | AZGXLGSCCZFBNH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane?
The IUPAC name of 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane (CID 10592414) is 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane.
What is the SMILES notation for 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane?
The canonical SMILES for 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane is Cc1cc(C2SCCCS2)cc(C2SCCCS2)c1.
What is the InChIKey of 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane?
The InChIKey is AZGXLGSCCZFBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20S4/c1-11-8-12(14-16-4-2-5-17-14)10-13(9-11)15-18-6-3-7-19-15/h8-10,14-15H,2-7H2,1H3.
What are the key properties of 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane?
2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane has a molecular weight of 328.59 g/mol, XLogP of 5.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,3-dithian-2-yl)-5-methylphenyl]-1,3-dithiane is sourced from PubChem (CID 10592414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).