C11H5ClF6N2O — CID 10592573
2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 10592573) has the molecular formula C11H5ClF6N2O and a molecular weight of 330.62 g/mol. Its IUPAC name is 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 10592573 |
| Molecular Formula | C11H5ClF6N2O |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)Cl)nc2ccccn12 |
| InChI | InChI=1S/C11H5ClF6N2O/c12-11(17,18)10(15,16)9(13,14)6-5-8(21)20-4-2-1-3-7(20)19-6/h1-5H |
| InChIKey | PLXUAOUTYKEDQO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|