C13H14NOS+ — CID 10592629
5-methyl-7,10-dihydro-6aH-thiopyrano[1,2-a][1,4]benzothiazin-11-ium-6-one (PubChem CID 10592629) has the molecular formula C13H14NOS+ and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-methyl-7,10-dihydro-6aH-thiopyrano[1,2-a][1,4]benzothiazin-11-ium-6-one.
| Compound Name | 5-methyl-7,10-dihydro-6aH-thiopyrano[1,2-a][1,4]benzothiazin-11-ium-6-one |
|---|---|
| PubChem CID | 10592629 |
| Molecular Formula | C13H14NOS+ |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-methyl-7,10-dihydro-6aH-thiopyrano[1,2-a][1,4]benzothiazin-11-ium-6-one |
| SMILES | CN1C(=O)C2CC=CC[S+]2c2ccccc21 |
| InChI | InChI=1S/C13H14NOS/c1-14-10-6-2-3-7-11(10)16-9-5-4-8-12(16)13(14)15/h2-7,12H,8-9H2,1H3/q+1 |
| InChIKey | VUSRCHNDNUJXBO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|