About 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene
1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene (PubChem CID 10592855) has the molecular formula C26H22
and a molecular weight of 334.46 g/mol. Its IUPAC name is 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene.
Molecular Properties
| Compound Name | 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene |
| PubChem CID | 10592855 |
| Molecular Formula | C26H22 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene |
| SMILES | Cc1ccc(C=C=Cc2ccc(C=C=Cc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H22/c1-21-9-13-23(14-10-21)5-3-7-25-17-19-26(20-18-25)8-4-6-24-15-11-22(2)12-16-24/h5-20H,1-2H3 |
| InChIKey | ALVVYDCWJIXRER-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene?
The IUPAC name of 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene (CID 10592855) is 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene.
What is the SMILES notation for 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene?
The canonical SMILES for 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene is Cc1ccc(C=C=Cc2ccc(C=C=Cc3ccc(C)cc3)cc2)cc1.
What is the InChIKey of 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene?
The InChIKey is ALVVYDCWJIXRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22/c1-21-9-13-23(14-10-21)5-3-7-25-17-19-26(20-18-25)8-4-6-24-15-11-22(2)12-16-24/h5-20H,1-2H3.
What are the key properties of 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene?
1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene has a molecular weight of 334.46 g/mol, XLogP of 6.95, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[3-(4-methylphenyl)propa-1,2-dienyl]benzene is sourced from PubChem (CID 10592855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).