C18H24O6 — CID 10592951
ethyl 4-[4-(4-ethoxy-4-oxobutyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoate (PubChem CID 10592951) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is ethyl 4-[4-(4-ethoxy-4-oxobutyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoate.
| Compound Name | ethyl 4-[4-(4-ethoxy-4-oxobutyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoate |
|---|---|
| PubChem CID | 10592951 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethyl 4-[4-(4-ethoxy-4-oxobutyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]butanoate |
| SMILES | CCOC(=O)CCCC1=CC(=O)C(CCCC(=O)OCC)=CC1=O |
| InChI | InChI=1S/C18H24O6/c1-3-23-17(21)9-5-7-13-11-16(20)14(12-15(13)19)8-6-10-18(22)24-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | RNHXDIUEVYARBM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|