C20H36N2O2 — CID 10593000
1-(3,5-dimethylpiperidin-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol (PubChem CID 10593000) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 10593000 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
| SMILES | CC1CC(C)CN(CC(O)CO/N=C2\C[C@@H]3CC[C@@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C20H36N2O2/c1-14-8-15(2)11-22(10-14)12-17(23)13-24-21-18-9-16-6-7-20(18,5)19(16,3)4/h14-17,23H,6-13H2,1-5H3/b21-18+/t14?,15?,16-,17?,20+/m0/s1 |
| InChIKey | QVWXPIFQDOOZBI-RACQJKFXSA-N |
| XLogP | 3.54 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|