C24H34O — CID 10593133
(8S,9R,13S,14S,17S)-3,3,13-trimethyl-17-[(2-methylpropan-2-yl)oxy]-8,9,14,15,16,17-hexahydro-2H-cyclopenta[a]phenanthrene (PubChem CID 10593133) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is (8S,9R,13S,14S,17S)-3,3,13-trimethyl-17-[(2-methylpropan-2-yl)oxy]-8,9,14,15,16,17-hexahydro-2H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,13S,14S,17S)-3,3,13-trimethyl-17-[(2-methylpropan-2-yl)oxy]-8,9,14,15,16,17-hexahydro-2H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 10593133 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (8S,9R,13S,14S,17S)-3,3,13-trimethyl-17-[(2-methylpropan-2-yl)oxy]-8,9,14,15,16,17-hexahydro-2H-cyclopenta[a]phenanthrene |
| SMILES | CC1(C)C=C2C=C[C@@H]3[C@@H](C=C[C@]4(C)[C@@H](OC(C)(C)C)CC[C@@H]34)C2=CC1 |
| InChI | InChI=1S/C24H34O/c1-22(2,3)25-21-10-9-20-19-8-7-16-15-23(4,5)13-11-17(16)18(19)12-14-24(20,21)6/h7-8,11-12,14-15,18-21H,9-10,13H2,1-6H3/t18-,19+,20-,21-,24-/m0/s1 |
| InChIKey | GYWWDIRRRZVPII-KEVRVKNQSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|