C16H20O8 — CID 10593232
[(1R,3R,4S,4aS,7aS)-1,4-diacetyloxy-7-methyl-5-oxo-3,4,4a,7a-tetrahydro-1H-cyclopenta[c]pyran-3-yl]methyl acetate (PubChem CID 10593232) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is [(1R,3R,4S,4aS,7aS)-1,4-diacetyloxy-7-methyl-5-oxo-3,4,4a,7a-tetrahydro-1H-cyclopenta[c]pyran-3-yl]methyl acetate.
| Compound Name | [(1R,3R,4S,4aS,7aS)-1,4-diacetyloxy-7-methyl-5-oxo-3,4,4a,7a-tetrahydro-1H-cyclopenta[c]pyran-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10593232 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(1R,3R,4S,4aS,7aS)-1,4-diacetyloxy-7-methyl-5-oxo-3,4,4a,7a-tetrahydro-1H-cyclopenta[c]pyran-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@@H]2C(C)=CC(=O)[C@@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H20O8/c1-7-5-11(20)14-13(7)16(23-10(4)19)24-12(6-21-8(2)17)15(14)22-9(3)18/h5,12-16H,6H2,1-4H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | XUAQZLXFCPIFSI-LJIZCISZSA-N |
| XLogP | 0.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|