About 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol
4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol (PubChem CID 10593267) has the molecular formula C23H20N2O
and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol.
Molecular Properties
| Compound Name | 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol |
| PubChem CID | 10593267 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol |
| SMILES | CCc1c(-c2ccccc2)nn(-c2ccc(O)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c1-2-21-22(17-9-5-3-6-10-17)24-25(19-13-15-20(26)16-14-19)23(21)18-11-7-4-8-12-18/h3-16,26H,2H2,1H3 |
| InChIKey | LVCJDIMRZPCSEH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol?
The IUPAC name of 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol (CID 10593267) is 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol.
What is the SMILES notation for 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol?
The canonical SMILES for 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol is CCc1c(-c2ccccc2)nn(-c2ccc(O)cc2)c1-c1ccccc1.
What is the InChIKey of 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol?
The InChIKey is LVCJDIMRZPCSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O/c1-2-21-22(17-9-5-3-6-10-17)24-25(19-13-15-20(26)16-14-19)23(21)18-11-7-4-8-12-18/h3-16,26H,2H2,1H3.
What are the key properties of 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol?
4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol has a molecular weight of 340.43 g/mol, XLogP of 5.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-3,5-diphenylpyrazol-1-yl)phenol is sourced from PubChem (CID 10593267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).