C11H13F3N2O5S — CID 10593373
N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetamide (PubChem CID 10593373) has the molecular formula C11H13F3N2O5S and a molecular weight of 342.30 g/mol. Its IUPAC name is N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetamide.
| Compound Name | N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetamide |
|---|---|
| PubChem CID | 10593373 |
| Molecular Formula | C11H13F3N2O5S |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2,2,2-trifluoroethyl)amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NO)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O5S/c1-21-8-2-4-9(5-3-8)22(19,20)16(6-10(17)15-18)7-11(12,13)14/h2-5,18H,6-7H2,1H3,(H,15,17) |
| InChIKey | QPQUTTGIKCBKTK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|