C18H34O4Si — CID 10593437
(E,8S)-8-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-8-hydroxyoct-5-enoic acid (PubChem CID 10593437) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (E,8S)-8-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-8-hydroxyoct-5-enoic acid.
| Compound Name | (E,8S)-8-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-8-hydroxyoct-5-enoic acid |
|---|---|
| PubChem CID | 10593437 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (E,8S)-8-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-8-hydroxyoct-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H]1[C@@H](O)C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C18H34O4Si/c1-18(2,3)23(4,5)22-13-14-12-15(14)16(19)10-8-6-7-9-11-17(20)21/h6,8,14-16,19H,7,9-13H2,1-5H3,(H,20,21)/b8-6+/t14-,15+,16-/m0/s1 |
| InChIKey | LKHUPJKCUBCCRO-WCUAFRCNSA-N |
| XLogP | 4.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|