C16H26O8 — CID 10593667
(5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethoxyoxolan-2-one (PubChem CID 10593667) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is (5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethoxyoxolan-2-one.
| Compound Name | (5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethoxyoxolan-2-one |
|---|---|
| PubChem CID | 10593667 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (5R)-5-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethoxyoxolan-2-one |
| SMILES | COC1(OC)C[C@H]([C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C16H26O8/c1-14(2)20-8-10(22-14)12-11(23-15(3,4)24-12)9-7-16(18-5,19-6)13(17)21-9/h9-12H,7-8H2,1-6H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | BBFVRBCAEGTCDF-DDHJBXDOSA-N |
| XLogP | 0.96 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|